C17H27N4O2+ — CID 8608878
(1R,5S)-2-amino-6,6-dibutyl-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 8608878) has the molecular formula C17H27N4O2+ and a molecular weight of 319.43 g/mol. Its IUPAC name is (1R,5S)-2-amino-6,6-dibutyl-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | (1R,5S)-2-amino-6,6-dibutyl-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 8608878 |
| Molecular Formula | C17H27N4O2+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (1R,5S)-2-amino-6,6-dibutyl-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCCC1(CCCC)[C@]2(C#N)C(OC)(OC)[NH+]=C(N)[C@]12C#N |
| InChI | InChI=1S/C17H26N4O2/c1-5-7-9-14(10-8-6-2)15(11-18)13(20)21-17(22-3,23-4)16(14,15)12-19/h5-10H2,1-4H3,(H2,20,21)/p+1/t15-,16+/m1/s1 |
| InChIKey | KAQVGXGQZYHICL-CVEARBPZSA-O |
| XLogP | 0.78 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|