C9H9BrCl2N2O — CID 86089298
2-bromo-N-(4,6-dichloro-3-pyridinyl)butanamide (PubChem CID 86089298) has the molecular formula C9H9BrCl2N2O and a molecular weight of 311.99 g/mol. Its IUPAC name is 2-bromo-N-(4,6-dichloro-3-pyridinyl)butanamide.
| Compound Name | 2-bromo-N-(4,6-dichloro-3-pyridinyl)butanamide |
|---|---|
| PubChem CID | 86089298 |
| Molecular Formula | C9H9BrCl2N2O |
| Molecular Weight | 311.99 g/mol |
| Exact Mass | 309.93 |
| IUPAC Name | 2-bromo-N-(4,6-dichloro-3-pyridinyl)butanamide |
| SMILES | CCC(Br)C(=O)Nc1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9BrCl2N2O/c1-2-5(10)9(15)14-7-4-13-8(12)3-6(7)11/h3-5H,2H2,1H3,(H,14,15) |
| InChIKey | HAYMNKJDIGVMON-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.99 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|