About 1,1-dibutyl-3,3-dimethylguanidine
1,1-dibutyl-3,3-dimethylguanidine (PubChem CID 86090035) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is 1,1-dibutyl-3,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1,1-dibutyl-3,3-dimethylguanidine |
| PubChem CID | 86090035 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 1,1-dibutyl-3,3-dimethylguanidine |
| SMILES | [H]/N=C(\N(C)C)N(CCCC)CCCC |
| InChI | InChI=1S/C11H25N3/c1-5-7-9-14(10-8-6-2)11(12)13(3)4/h12H,5-10H2,1-4H3/b12-11+ |
| InChIKey | QHRGCSLHJLHKDF-VAWYXSNFSA-N |
| XLogP | 2.38 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibutyl-3,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibutyl-3,3-dimethylguanidine?
The IUPAC name of 1,1-dibutyl-3,3-dimethylguanidine (CID 86090035) is 1,1-dibutyl-3,3-dimethylguanidine.
What is the SMILES notation for 1,1-dibutyl-3,3-dimethylguanidine?
The canonical SMILES for 1,1-dibutyl-3,3-dimethylguanidine is [H]/N=C(\N(C)C)N(CCCC)CCCC.
What is the InChIKey of 1,1-dibutyl-3,3-dimethylguanidine?
The InChIKey is QHRGCSLHJLHKDF-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H25N3/c1-5-7-9-14(10-8-6-2)11(12)13(3)4/h12H,5-10H2,1-4H3/b12-11+.
What are the key properties of 1,1-dibutyl-3,3-dimethylguanidine?
1,1-dibutyl-3,3-dimethylguanidine has a molecular weight of 199.34 g/mol, XLogP of 2.38, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibutyl-3,3-dimethylguanidine is sourced from PubChem (CID 86090035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).