C34H32N6O2 — CID 86090281
3,9-dibenzyl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione (PubChem CID 86090281) has the molecular formula C34H32N6O2 and a molecular weight of 556.67 g/mol. Its IUPAC name is 3,9-dibenzyl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione.
| Compound Name | 3,9-dibenzyl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
|---|---|
| PubChem CID | 86090281 |
| Molecular Formula | C34H32N6O2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | 3,9-dibenzyl-12,13-diphenyl-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
| SMILES | O=C1N2CN(Cc3ccccc3)CN3C(=O)N4CN(Cc5ccccc5)CN1C4(c1ccccc1)C23c1ccccc1 |
| InChI | InChI=1S/C34H32N6O2/c41-31-37-23-35(21-27-13-5-1-6-14-27)24-38-32(42)40-26-36(22-28-15-7-2-8-16-28)25-39(31)34(40,30-19-11-4-12-20-30)33(37,38)29-17-9-3-10-18-29/h1-20H,21-26H2 |
| InChIKey | JOUUJTLBAMHFFA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |