About 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine
1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine (PubChem CID 86090524) has the molecular formula C17H18N2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine.
Molecular Properties
| Compound Name | 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine |
| PubChem CID | 86090524 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine |
| SMILES | C=C(C)C1=CCCc2c(-c3ccccc3)ncn2C1 |
| InChI | InChI=1S/C17H18N2/c1-13(2)15-9-6-10-16-17(18-12-19(16)11-15)14-7-4-3-5-8-14/h3-5,7-9,12H,1,6,10-11H2,2H3 |
| InChIKey | ZICKIBKASMPMNN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine?
The IUPAC name of 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine (CID 86090524) is 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine.
What is the SMILES notation for 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine?
The canonical SMILES for 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine is C=C(C)C1=CCCc2c(-c3ccccc3)ncn2C1.
What is the InChIKey of 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine?
The InChIKey is ZICKIBKASMPMNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2/c1-13(2)15-9-6-10-16-17(18-12-19(16)11-15)14-7-4-3-5-8-14/h3-5,7-9,12H,1,6,10-11H2,2H3.
What are the key properties of 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine?
1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine has a molecular weight of 250.34 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-6-prop-1-en-2-yl-8,9-dihydro-5H-imidazo[1,5-a]azepine is sourced from PubChem (CID 86090524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).