C10H10N4O2 — CID 8609155
(1'S,2R,4S,5'R)-2'-amino-4-methylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8609155) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is (1'S,2R,4S,5'R)-2'-amino-4-methylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,2R,4S,5'R)-2'-amino-4-methylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8609155 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (1'S,2R,4S,5'R)-2'-amino-4-methylspiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | C[C@H]1CO[C@@]2(N=C(N)[C@@]3(C#N)C[C@@]23C#N)O1 |
| InChI | InChI=1S/C10H10N4O2/c1-6-2-15-10(16-6)9(5-12)3-8(9,4-11)7(13)14-10/h6H,2-3H2,1H3,(H2,13,14)/t6-,8-,9-,10+/m0/s1 |
| InChIKey | FTXDSMQBINPJKM-MIBSWOBISA-N |
| XLogP | -0.13 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |