About 2-(6-methyloctyl)oxirane
2-(6-methyloctyl)oxirane (PubChem CID 86091626) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is 2-(6-methyloctyl)oxirane.
Molecular Properties
| Compound Name | 2-(6-methyloctyl)oxirane |
| PubChem CID | 86091626 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 2-(6-methyloctyl)oxirane |
| SMILES | CCC(C)CCCCCC1CO1 |
| InChI | InChI=1S/C11H22O/c1-3-10(2)7-5-4-6-8-11-9-12-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | ZTZIGYKTNOLUFD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-methyloctyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyloctyl)oxirane?
The IUPAC name of 2-(6-methyloctyl)oxirane (CID 86091626) is 2-(6-methyloctyl)oxirane.
What is the SMILES notation for 2-(6-methyloctyl)oxirane?
The canonical SMILES for 2-(6-methyloctyl)oxirane is CCC(C)CCCCCC1CO1.
What is the InChIKey of 2-(6-methyloctyl)oxirane?
The InChIKey is ZTZIGYKTNOLUFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-3-10(2)7-5-4-6-8-11-9-12-11/h10-11H,3-9H2,1-2H3.
What are the key properties of 2-(6-methyloctyl)oxirane?
2-(6-methyloctyl)oxirane has a molecular weight of 170.30 g/mol, XLogP of 3.38, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyloctyl)oxirane is sourced from PubChem (CID 86091626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).