C7H7N3S2 — CID 86091773
5,6-dimethyl-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione (PubChem CID 86091773) has the molecular formula C7H7N3S2 and a molecular weight of 197.29 g/mol. Its IUPAC name is 5,6-dimethyl-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione.
| Compound Name | 5,6-dimethyl-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione |
|---|---|
| PubChem CID | 86091773 |
| Molecular Formula | C7H7N3S2 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 5,6-dimethyl-3H-[1,3]thiazolo[4,5-b]pyrazine-2-thione |
| SMILES | Cc1nc2[nH]c(=S)sc2nc1C |
| InChI | InChI=1S/C7H7N3S2/c1-3-4(2)9-6-5(8-3)10-7(11)12-6/h1-2H3,(H,8,10,11) |
| InChIKey | FYNQHIGJEJECHO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|