C12H18N2O4 — CID 86092021
2-amino-N-[2-(2,6-dimethoxyphenyl)-2-hydroxyethyl]acetamide (PubChem CID 86092021) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-amino-N-[2-(2,6-dimethoxyphenyl)-2-hydroxyethyl]acetamide.
| Compound Name | 2-amino-N-[2-(2,6-dimethoxyphenyl)-2-hydroxyethyl]acetamide |
|---|---|
| PubChem CID | 86092021 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-amino-N-[2-(2,6-dimethoxyphenyl)-2-hydroxyethyl]acetamide |
| SMILES | COc1cccc(OC)c1C(O)CNC(=O)CN |
| InChI | InChI=1S/C12H18N2O4/c1-17-9-4-3-5-10(18-2)12(9)8(15)7-14-11(16)6-13/h3-5,8,15H,6-7,13H2,1-2H3,(H,14,16) |
| InChIKey | VCGKSWVJMJGZLB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |