C16H13N3 — CID 86092413
2-(6-methyl-2,3,4,9-tetrahydrocarbazol-1-ylidene)propanedinitrile (PubChem CID 86092413) has the molecular formula C16H13N3 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-(6-methyl-2,3,4,9-tetrahydrocarbazol-1-ylidene)propanedinitrile.
| Compound Name | 2-(6-methyl-2,3,4,9-tetrahydrocarbazol-1-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 86092413 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-(6-methyl-2,3,4,9-tetrahydrocarbazol-1-ylidene)propanedinitrile |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCCC3=C(C#N)C#N |
| InChI | InChI=1S/C16H13N3/c1-10-5-6-15-14(7-10)13-4-2-3-12(16(13)19-15)11(8-17)9-18/h5-7,19H,2-4H2,1H3 |
| InChIKey | AAIQTOVOIYCCNW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|