C8H9F9O3S — CID 86094482
2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)ethanol (PubChem CID 86094482) has the molecular formula C8H9F9O3S and a molecular weight of 356.21 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)ethanol.
| Compound Name | 2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)ethanol |
|---|---|
| PubChem CID | 86094482 |
| Molecular Formula | C8H9F9O3S |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)ethanol |
| SMILES | O=S(=O)(CCO)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9O3S/c9-5(10,1-3-21(19,20)4-2-18)6(11,12)7(13,14)8(15,16)17/h18H,1-4H2 |
| InChIKey | YHTRHEPWLUPOBX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|