About 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete
2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete (PubChem CID 86094509) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete.
Molecular Properties
| Compound Name | 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete |
| PubChem CID | 86094509 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete |
| SMILES | C=CC1CC(SCC)=N1 |
| InChI | InChI=1S/C7H11NS/c1-3-6-5-7(8-6)9-4-2/h3,6H,1,4-5H2,2H3 |
| InChIKey | RJDWZLZFPBBFQN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete?
The IUPAC name of 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete (CID 86094509) is 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete.
What is the SMILES notation for 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete?
The canonical SMILES for 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete is C=CC1CC(SCC)=N1.
What is the InChIKey of 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete?
The InChIKey is RJDWZLZFPBBFQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS/c1-3-6-5-7(8-6)9-4-2/h3,6H,1,4-5H2,2H3.
What are the key properties of 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete?
2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete has a molecular weight of 141.24 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-4-ethylsulfanyl-2,3-dihydroazete is sourced from PubChem (CID 86094509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).