C20H25NO2 — CID 86094874
N-(4-hexoxyphenyl)-1-(4-methoxyphenyl)methanimine (PubChem CID 86094874) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-(4-hexoxyphenyl)-1-(4-methoxyphenyl)methanimine.
| Compound Name | N-(4-hexoxyphenyl)-1-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 86094874 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | N-(4-hexoxyphenyl)-1-(4-methoxyphenyl)methanimine |
| SMILES | CCCCCCOc1ccc(/N=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H25NO2/c1-3-4-5-6-15-23-20-13-9-18(10-14-20)21-16-17-7-11-19(22-2)12-8-17/h7-14,16H,3-6,15H2,1-2H3/b21-16+ |
| InChIKey | YCYCGDBFRYOUPM-LTGZKZEYSA-N |
| XLogP | 5.40 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|