About 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one
2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one (PubChem CID 86095407) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one |
| PubChem CID | 86095407 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CCC(=CO)C(=O)C1 |
| InChI | InChI=1S/C9H14O2/c1-9(2)4-3-7(6-10)8(11)5-9/h6,10H,3-5H2,1-2H3 |
| InChIKey | LKQHFSVUXVVIQO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one?
The IUPAC name of 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one (CID 86095407) is 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one.
What is the SMILES notation for 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one?
The canonical SMILES for 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one is CC1(C)CCC(=CO)C(=O)C1.
What is the InChIKey of 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one?
The InChIKey is LKQHFSVUXVVIQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-9(2)4-3-7(6-10)8(11)5-9/h6,10H,3-5H2,1-2H3.
What are the key properties of 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one?
2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one has a molecular weight of 154.21 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethylidene)-5,5-dimethylcyclohexan-1-one is sourced from PubChem (CID 86095407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).