C9H12O3 — CID 86095486
5-hydroxy-4,6,6-trimethylcyclohex-4-ene-1,3-dione (PubChem CID 86095486) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 5-hydroxy-4,6,6-trimethylcyclohex-4-ene-1,3-dione.
| Compound Name | 5-hydroxy-4,6,6-trimethylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 86095486 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 5-hydroxy-4,6,6-trimethylcyclohex-4-ene-1,3-dione |
| SMILES | CC1=C(O)C(C)(C)C(=O)CC1=O |
| InChI | InChI=1S/C9H12O3/c1-5-6(10)4-7(11)9(2,3)8(5)12/h12H,4H2,1-3H3 |
| InChIKey | APMOMMBTSMGEHZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|