About 2-propan-2-yl-1,2-dihydroquinoxaline
2-propan-2-yl-1,2-dihydroquinoxaline (PubChem CID 86095880) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-propan-2-yl-1,2-dihydroquinoxaline.
Molecular Properties
| Compound Name | 2-propan-2-yl-1,2-dihydroquinoxaline |
| PubChem CID | 86095880 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-propan-2-yl-1,2-dihydroquinoxaline |
| SMILES | CC(C)C1C=Nc2ccccc2N1 |
| InChI | InChI=1S/C11H14N2/c1-8(2)11-7-12-9-5-3-4-6-10(9)13-11/h3-8,11,13H,1-2H3 |
| InChIKey | OHUSVZGPMSSFCM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yl-1,2-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1,2-dihydroquinoxaline?
The IUPAC name of 2-propan-2-yl-1,2-dihydroquinoxaline (CID 86095880) is 2-propan-2-yl-1,2-dihydroquinoxaline.
What is the SMILES notation for 2-propan-2-yl-1,2-dihydroquinoxaline?
The canonical SMILES for 2-propan-2-yl-1,2-dihydroquinoxaline is CC(C)C1C=Nc2ccccc2N1.
What is the InChIKey of 2-propan-2-yl-1,2-dihydroquinoxaline?
The InChIKey is OHUSVZGPMSSFCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-8(2)11-7-12-9-5-3-4-6-10(9)13-11/h3-8,11,13H,1-2H3.
What are the key properties of 2-propan-2-yl-1,2-dihydroquinoxaline?
2-propan-2-yl-1,2-dihydroquinoxaline has a molecular weight of 174.25 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1,2-dihydroquinoxaline is sourced from PubChem (CID 86095880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).