C9H11F7O3 — CID 86096159
1,1-diethoxy-3,3,4,4,5,5,5-heptafluoropentan-2-one (PubChem CID 86096159) has the molecular formula C9H11F7O3 and a molecular weight of 300.17 g/mol. Its IUPAC name is 1,1-diethoxy-3,3,4,4,5,5,5-heptafluoropentan-2-one.
| Compound Name | 1,1-diethoxy-3,3,4,4,5,5,5-heptafluoropentan-2-one |
|---|---|
| PubChem CID | 86096159 |
| Molecular Formula | C9H11F7O3 |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1,1-diethoxy-3,3,4,4,5,5,5-heptafluoropentan-2-one |
| SMILES | CCOC(OCC)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F7O3/c1-3-18-6(19-4-2)5(17)7(10,11)8(12,13)9(14,15)16/h6H,3-4H2,1-2H3 |
| InChIKey | YWSQTHPZHZFSND-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|