C27H27NO9 — CID 86096219
3-[2-[bis[2-(3-carboxyphenoxy)ethyl]amino]ethoxy]benzoic acid (PubChem CID 86096219) has the molecular formula C27H27NO9 and a molecular weight of 509.51 g/mol. Its IUPAC name is 3-[2-[bis[2-(3-carboxyphenoxy)ethyl]amino]ethoxy]benzoic acid.
| Compound Name | 3-[2-[bis[2-(3-carboxyphenoxy)ethyl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 86096219 |
| Molecular Formula | C27H27NO9 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 3-[2-[bis[2-(3-carboxyphenoxy)ethyl]amino]ethoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCCN(CCOc2cccc(C(=O)O)c2)CCOc2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C27H27NO9/c29-25(30)19-4-1-7-22(16-19)35-13-10-28(11-14-36-23-8-2-5-20(17-23)26(31)32)12-15-37-24-9-3-6-21(18-24)27(33)34/h1-9,16-18H,10-15H2,(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | VPAGGTHVLDDXAM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |