About 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one
1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one (PubChem CID 86097338) has the molecular formula C15H17NOSe
and a molecular weight of 306.27 g/mol. Its IUPAC name is 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one |
| PubChem CID | 86097338 |
| Molecular Formula | C15H17NOSe |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one |
| SMILES | C=C=CCCN1C(=O)CCC1[Se]c1ccccc1 |
| InChI | InChI=1S/C15H17NOSe/c1-2-3-7-12-16-14(17)10-11-15(16)18-13-8-5-4-6-9-13/h3-6,8-9,15H,1,7,10-12H2 |
| InChIKey | JYEAXKHZQOBGHC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one?
The IUPAC name of 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one (CID 86097338) is 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one.
What is the SMILES notation for 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one?
The canonical SMILES for 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one is C=C=CCCN1C(=O)CCC1[Se]c1ccccc1.
What is the InChIKey of 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one?
The InChIKey is JYEAXKHZQOBGHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NOSe/c1-2-3-7-12-16-14(17)10-11-15(16)18-13-8-5-4-6-9-13/h3-6,8-9,15H,1,7,10-12H2.
What are the key properties of 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one?
1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one has a molecular weight of 306.27 g/mol, XLogP of 1.70, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-penta-3,4-dienyl-5-phenylselanylpyrrolidin-2-one is sourced from PubChem (CID 86097338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).