About 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol
6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol (PubChem CID 86098098) has the molecular formula C18H20O5
and a molecular weight of 316.35 g/mol. Its IUPAC name is 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol.
Molecular Properties
| Compound Name | 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol |
| PubChem CID | 86098098 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol |
| SMILES | COc1cc2c(cc1OC)C(O)(c1ccccc1OC)OCC2 |
| InChI | InChI=1S/C18H20O5/c1-20-15-7-5-4-6-13(15)18(19)14-11-17(22-3)16(21-2)10-12(14)8-9-23-18/h4-7,10-11,19H,8-9H2,1-3H3 |
| InChIKey | BCSDBFANJLBNMB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol?
The IUPAC name of 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol (CID 86098098) is 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol.
What is the SMILES notation for 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol?
The canonical SMILES for 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol is COc1cc2c(cc1OC)C(O)(c1ccccc1OC)OCC2.
What is the InChIKey of 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol?
The InChIKey is BCSDBFANJLBNMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O5/c1-20-15-7-5-4-6-13(15)18(19)14-11-17(22-3)16(21-2)10-12(14)8-9-23-18/h4-7,10-11,19H,8-9H2,1-3H3.
What are the key properties of 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol?
6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol has a molecular weight of 316.35 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-1-(2-methoxyphenyl)-3,4-dihydroisochromen-1-ol is sourced from PubChem (CID 86098098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).