About methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate
methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate (PubChem CID 86099496) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate.
Molecular Properties
| Compound Name | methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate |
| PubChem CID | 86099496 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate |
| SMILES | C=C=CCC(C(=O)OC)C(=O)C(C)C |
| InChI | InChI=1S/C11H16O3/c1-5-6-7-9(11(13)14-4)10(12)8(2)3/h6,8-9H,1,7H2,2-4H3 |
| InChIKey | LTUNGHTXTOFYQE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate?
The IUPAC name of methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate (CID 86099496) is methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate.
What is the SMILES notation for methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate?
The canonical SMILES for methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate is C=C=CCC(C(=O)OC)C(=O)C(C)C.
What is the InChIKey of methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate?
The InChIKey is LTUNGHTXTOFYQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-5-6-7-9(11(13)14-4)10(12)8(2)3/h6,8-9H,1,7H2,2-4H3.
What are the key properties of methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate?
methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate has a molecular weight of 196.25 g/mol, XLogP of 1.73, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-methylpropanoyl)hexa-4,5-dienoate is sourced from PubChem (CID 86099496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).