About triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane
triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane (PubChem CID 86100588) has the molecular formula C17H25FOSi
and a molecular weight of 292.47 g/mol. Its IUPAC name is triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane.
Molecular Properties
| Compound Name | triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane |
| PubChem CID | 86100588 |
| Molecular Formula | C17H25FOSi |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane |
| SMILES | CC[Si](CC)(CC)OC1=C(F)CCCc2ccccc21 |
| InChI | InChI=1S/C17H25FOSi/c1-4-20(5-2,6-3)19-17-15-12-8-7-10-14(15)11-9-13-16(17)18/h7-8,10,12H,4-6,9,11,13H2,1-3H3 |
| InChIKey | TYCFMPKBLUKORQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane?
The IUPAC name of triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane (CID 86100588) is triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane.
What is the SMILES notation for triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane?
The canonical SMILES for triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane is CC[Si](CC)(CC)OC1=C(F)CCCc2ccccc21.
What is the InChIKey of triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane?
The InChIKey is TYCFMPKBLUKORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25FOSi/c1-4-20(5-2,6-3)19-17-15-12-8-7-10-14(15)11-9-13-16(17)18/h7-8,10,12H,4-6,9,11,13H2,1-3H3.
What are the key properties of triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane?
triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane has a molecular weight of 292.47 g/mol, XLogP of 5.68, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(6-fluoro-8,9-dihydro-7H-benzo[7]annulen-5-yl)oxy]silane is sourced from PubChem (CID 86100588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).