About 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane
2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane (PubChem CID 86100822) has the molecular formula C11H11BrS2Si
and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane |
| PubChem CID | 86100822 |
| Molecular Formula | C11H11BrS2Si |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1sc2ccsc2c1Br |
| InChI | InChI=1S/C11H11BrS2Si/c1-15(2,3)7-5-8-10(12)11-9(14-8)4-6-13-11/h4,6H,1-3H3 |
| InChIKey | UYAJNUMGHZZMLT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane?
The IUPAC name of 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane (CID 86100822) is 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane.
What is the SMILES notation for 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane?
The canonical SMILES for 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane is C[Si](C)(C)C#Cc1sc2ccsc2c1Br.
What is the InChIKey of 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane?
The InChIKey is UYAJNUMGHZZMLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrS2Si/c1-15(2,3)7-5-8-10(12)11-9(14-8)4-6-13-11/h4,6H,1-3H3.
What are the key properties of 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane?
2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane has a molecular weight of 315.33 g/mol, XLogP of 4.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromothieno[3,2-b]thiophen-5-yl)ethynyl-trimethylsilane is sourced from PubChem (CID 86100822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).