About N,N'-dibutylpropanimidamide
N,N'-dibutylpropanimidamide (PubChem CID 86103188) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is N,N'-dibutylpropanimidamide.
Molecular Properties
| Compound Name | N,N'-dibutylpropanimidamide |
| PubChem CID | 86103188 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N,N'-dibutylpropanimidamide |
| SMILES | CCCC/N=C(\CC)NCCCC |
| InChI | InChI=1S/C11H24N2/c1-4-7-9-12-11(6-3)13-10-8-5-2/h4-10H2,1-3H3,(H,12,13) |
| InChIKey | FTNJDQKLVQFVAJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dibutylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dibutylpropanimidamide?
The IUPAC name of N,N'-dibutylpropanimidamide (CID 86103188) is N,N'-dibutylpropanimidamide.
What is the SMILES notation for N,N'-dibutylpropanimidamide?
The canonical SMILES for N,N'-dibutylpropanimidamide is CCCC/N=C(\CC)NCCCC.
What is the InChIKey of N,N'-dibutylpropanimidamide?
The InChIKey is FTNJDQKLVQFVAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2/c1-4-7-9-12-11(6-3)13-10-8-5-2/h4-10H2,1-3H3,(H,12,13).
What are the key properties of N,N'-dibutylpropanimidamide?
N,N'-dibutylpropanimidamide has a molecular weight of 184.33 g/mol, XLogP of 2.98, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dibutylpropanimidamide is sourced from PubChem (CID 86103188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).