About 1-butyl-2-ethyl-4,5-dihydroimidazole
1-butyl-2-ethyl-4,5-dihydroimidazole (PubChem CID 86103198) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-butyl-2-ethyl-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-butyl-2-ethyl-4,5-dihydroimidazole |
| PubChem CID | 86103198 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-butyl-2-ethyl-4,5-dihydroimidazole |
| SMILES | CCCCN1CCN=C1CC |
| InChI | InChI=1S/C9H18N2/c1-3-5-7-11-8-6-10-9(11)4-2/h3-8H2,1-2H3 |
| InChIKey | GMZAFPHMDPOUGL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-2-ethyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-ethyl-4,5-dihydroimidazole?
The IUPAC name of 1-butyl-2-ethyl-4,5-dihydroimidazole (CID 86103198) is 1-butyl-2-ethyl-4,5-dihydroimidazole.
What is the SMILES notation for 1-butyl-2-ethyl-4,5-dihydroimidazole?
The canonical SMILES for 1-butyl-2-ethyl-4,5-dihydroimidazole is CCCCN1CCN=C1CC.
What is the InChIKey of 1-butyl-2-ethyl-4,5-dihydroimidazole?
The InChIKey is GMZAFPHMDPOUGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-3-5-7-11-8-6-10-9(11)4-2/h3-8H2,1-2H3.
What are the key properties of 1-butyl-2-ethyl-4,5-dihydroimidazole?
1-butyl-2-ethyl-4,5-dihydroimidazole has a molecular weight of 154.26 g/mol, XLogP of 1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-ethyl-4,5-dihydroimidazole is sourced from PubChem (CID 86103198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).