C6CdF14 — CID 86104744
cadmium(2+);bis(1,1,1,2,3,3,3-heptafluoropropane) (PubChem CID 86104744) has the molecular formula C6CdF14 and a molecular weight of 450.45 g/mol. Its IUPAC name is cadmium(2+);bis(1,1,1,2,3,3,3-heptafluoropropane).
| Compound Name | cadmium(2+);bis(1,1,1,2,3,3,3-heptafluoropropane) |
|---|---|
| PubChem CID | 86104744 |
| Molecular Formula | C6CdF14 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 451.88 |
| IUPAC Name | cadmium(2+);bis(1,1,1,2,3,3,3-heptafluoropropane) |
| SMILES | F[C-](C(F)(F)F)C(F)(F)F.F[C-](C(F)(F)F)C(F)(F)F.[Cd+2] |
| InChI | InChI=1S/2C3F7.Cd/c2*4-1(2(5,6)7)3(8,9)10;/q2*-1;+2 |
| InChIKey | QJLPEVMCJYDDQJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|