About 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one
4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one (PubChem CID 86105942) has the molecular formula C12H8BrNO3
and a molecular weight of 294.10 g/mol. Its IUPAC name is 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one.
Molecular Properties
| Compound Name | 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one |
| PubChem CID | 86105942 |
| Molecular Formula | C12H8BrNO3 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one |
| SMILES | Cc1cc(=O)c2cc3nc(C)oc3c(Br)c2o1 |
| InChI | InChI=1S/C12H8BrNO3/c1-5-3-9(15)7-4-8-12(17-6(2)14-8)10(13)11(7)16-5/h3-4H,1-2H3 |
| InChIKey | JCXFMRMLAFEUBR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one?
The IUPAC name of 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one (CID 86105942) is 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one.
What is the SMILES notation for 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one?
The canonical SMILES for 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one is Cc1cc(=O)c2cc3nc(C)oc3c(Br)c2o1.
What is the InChIKey of 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one?
The InChIKey is JCXFMRMLAFEUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrNO3/c1-5-3-9(15)7-4-8-12(17-6(2)14-8)10(13)11(7)16-5/h3-4H,1-2H3.
What are the key properties of 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one?
4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one has a molecular weight of 294.10 g/mol, XLogP of 3.31, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-dimethylpyrano[3,2-f][1,3]benzoxazol-8-one is sourced from PubChem (CID 86105942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).