About 2-purin-9-ylethanamine
2-purin-9-ylethanamine (PubChem CID 86106662) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-purin-9-ylethanamine.
Molecular Properties
| Compound Name | 2-purin-9-ylethanamine |
| PubChem CID | 86106662 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 2-purin-9-ylethanamine |
| SMILES | NCCn1cnc2cncnc21 |
| InChI | InChI=1S/C7H9N5/c8-1-2-12-5-11-6-3-9-4-10-7(6)12/h3-5H,1-2,8H2 |
| InChIKey | MRPVHSOMGNNIQQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-purin-9-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-purin-9-ylethanamine?
The IUPAC name of 2-purin-9-ylethanamine (CID 86106662) is 2-purin-9-ylethanamine.
What is the SMILES notation for 2-purin-9-ylethanamine?
The canonical SMILES for 2-purin-9-ylethanamine is NCCn1cnc2cncnc21.
What is the InChIKey of 2-purin-9-ylethanamine?
The InChIKey is MRPVHSOMGNNIQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c8-1-2-12-5-11-6-3-9-4-10-7(6)12/h3-5H,1-2,8H2.
What are the key properties of 2-purin-9-ylethanamine?
2-purin-9-ylethanamine has a molecular weight of 163.18 g/mol, XLogP of -0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-purin-9-ylethanamine is sourced from PubChem (CID 86106662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).