C15H13FN2O5S — CID 8611161
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3-thiophen-3-ylpropanoate (PubChem CID 8611161) has the molecular formula C15H13FN2O5S and a molecular weight of 352.34 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3-thiophen-3-ylpropanoate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 8611161 |
| Molecular Formula | C15H13FN2O5S |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 3-thiophen-3-ylpropanoate |
| SMILES | O=C(COC(=O)CCc1ccsc1)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C15H13FN2O5S/c16-12-3-2-11(18(21)22)7-13(12)17-14(19)8-23-15(20)4-1-10-5-6-24-9-10/h2-3,5-7,9H,1,4,8H2,(H,17,19) |
| InChIKey | RPUHWCUBMWFCLH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|