About [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate
[2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate (PubChem CID 8611284) has the molecular formula C17H16N4O5S
and a molecular weight of 388.41 g/mol. Its IUPAC name is [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate.
Molecular Properties
| Compound Name | [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate |
| PubChem CID | 8611284 |
| Molecular Formula | C17H16N4O5S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate |
| SMILES | CN1CCN(c2nc3ccc(OC(=O)c4ccc([N+](=O)[O-])o4)cc3s2)CC1 |
| InChI | InChI=1S/C17H16N4O5S/c1-19-6-8-20(9-7-19)17-18-12-3-2-11(10-14(12)27-17)25-16(22)13-4-5-15(26-13)21(23)24/h2-5,10H,6-9H2,1H3 |
| InChIKey | SDEPQLGOFOSRAE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate?
The IUPAC name of [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate (CID 8611284) is [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate.
What is the SMILES notation for [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate?
The canonical SMILES for [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate is CN1CCN(c2nc3ccc(OC(=O)c4ccc([N+](=O)[O-])o4)cc3s2)CC1.
What is the InChIKey of [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate?
The InChIKey is SDEPQLGOFOSRAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O5S/c1-19-6-8-20(9-7-19)17-18-12-3-2-11(10-14(12)27-17)25-16(22)13-4-5-15(26-13)21(23)24/h2-5,10H,6-9H2,1H3.
What are the key properties of [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate?
[2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate has a molecular weight of 388.41 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 5-nitrofuran-2-carboxylate is sourced from PubChem (CID 8611284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).