About CID 86113620
CID 86113620 (PubChem CID 86113620) has the molecular formula C4H11GeO
and a molecular weight of 147.74 g/mol.
Molecular Properties
| Compound Name | CID 86113620 |
| PubChem CID | 86113620 |
| Molecular Formula | C4H11GeO |
| Molecular Weight | 147.74 g/mol |
| Exact Mass | 149.00 |
| IUPAC Name | — |
| SMILES | CCO[Ge](C)C |
| InChI | InChI=1S/C4H11GeO/c1-4-6-5(2)3/h4H2,1-3H3 |
| InChIKey | WALSXABCIJBUOO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.74 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 86113620 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86113620?
The IUPAC name of CID 86113620 (CID 86113620) is not available.
What is the SMILES notation for CID 86113620?
The canonical SMILES for CID 86113620 is CCO[Ge](C)C.
What is the InChIKey of CID 86113620?
The InChIKey is WALSXABCIJBUOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11GeO/c1-4-6-5(2)3/h4H2,1-3H3.
What are the key properties of CID 86113620?
CID 86113620 has a molecular weight of 147.74 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86113620 is sourced from PubChem (CID 86113620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).