About 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane
2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane (PubChem CID 86116213) has the molecular formula C10H12S2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane.
Molecular Properties
| Compound Name | 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane |
| PubChem CID | 86116213 |
| Molecular Formula | C10H12S2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane |
| SMILES | C1=CC(=C2SCCCCS2)C=C1 |
| InChI | InChI=1S/C10H12S2/c1-2-6-9(5-1)10-11-7-3-4-8-12-10/h1-2,5-6H,3-4,7-8H2 |
| InChIKey | QUDAZWRUFXXSHI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane?
The IUPAC name of 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane (CID 86116213) is 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane.
What is the SMILES notation for 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane?
The canonical SMILES for 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane is C1=CC(=C2SCCCCS2)C=C1.
What is the InChIKey of 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane?
The InChIKey is QUDAZWRUFXXSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12S2/c1-2-6-9(5-1)10-11-7-3-4-8-12-10/h1-2,5-6H,3-4,7-8H2.
What are the key properties of 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane?
2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane has a molecular weight of 196.34 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-2,4-dien-1-ylidene-1,3-dithiepane is sourced from PubChem (CID 86116213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).