About 3-chloropropyl 2,2,2-trifluoroethanesulfonate
3-chloropropyl 2,2,2-trifluoroethanesulfonate (PubChem CID 86116568) has the molecular formula C5H8ClF3O3S
and a molecular weight of 240.63 g/mol. Its IUPAC name is 3-chloropropyl 2,2,2-trifluoroethanesulfonate.
Molecular Properties
| Compound Name | 3-chloropropyl 2,2,2-trifluoroethanesulfonate |
| PubChem CID | 86116568 |
| Molecular Formula | C5H8ClF3O3S |
| Molecular Weight | 240.63 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 3-chloropropyl 2,2,2-trifluoroethanesulfonate |
| SMILES | O=S(=O)(CC(F)(F)F)OCCCCl |
| InChI | InChI=1S/C5H8ClF3O3S/c6-2-1-3-12-13(10,11)4-5(7,8)9/h1-4H2 |
| InChIKey | AVLFAVHKCYMGCF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.63 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropyl 2,2,2-trifluoroethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropyl 2,2,2-trifluoroethanesulfonate?
The IUPAC name of 3-chloropropyl 2,2,2-trifluoroethanesulfonate (CID 86116568) is 3-chloropropyl 2,2,2-trifluoroethanesulfonate.
What is the SMILES notation for 3-chloropropyl 2,2,2-trifluoroethanesulfonate?
The canonical SMILES for 3-chloropropyl 2,2,2-trifluoroethanesulfonate is O=S(=O)(CC(F)(F)F)OCCCCl.
What is the InChIKey of 3-chloropropyl 2,2,2-trifluoroethanesulfonate?
The InChIKey is AVLFAVHKCYMGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClF3O3S/c6-2-1-3-12-13(10,11)4-5(7,8)9/h1-4H2.
What are the key properties of 3-chloropropyl 2,2,2-trifluoroethanesulfonate?
3-chloropropyl 2,2,2-trifluoroethanesulfonate has a molecular weight of 240.63 g/mol, XLogP of 1.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropyl 2,2,2-trifluoroethanesulfonate is sourced from PubChem (CID 86116568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).