About 2-(dichloromethyl)-1,3-dioxolan-2-ol
2-(dichloromethyl)-1,3-dioxolan-2-ol (PubChem CID 86116885) has the molecular formula C4H6Cl2O3
and a molecular weight of 172.99 g/mol. Its IUPAC name is 2-(dichloromethyl)-1,3-dioxolan-2-ol.
Molecular Properties
| Compound Name | 2-(dichloromethyl)-1,3-dioxolan-2-ol |
| PubChem CID | 86116885 |
| Molecular Formula | C4H6Cl2O3 |
| Molecular Weight | 172.99 g/mol |
| Exact Mass | 171.97 |
| IUPAC Name | 2-(dichloromethyl)-1,3-dioxolan-2-ol |
| SMILES | OC1(C(Cl)Cl)OCCO1 |
| InChI | InChI=1S/C4H6Cl2O3/c5-3(6)4(7)8-1-2-9-4/h3,7H,1-2H2 |
| InChIKey | MWEVIXURMXKKSE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.99 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dichloromethyl)-1,3-dioxolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dichloromethyl)-1,3-dioxolan-2-ol?
The IUPAC name of 2-(dichloromethyl)-1,3-dioxolan-2-ol (CID 86116885) is 2-(dichloromethyl)-1,3-dioxolan-2-ol.
What is the SMILES notation for 2-(dichloromethyl)-1,3-dioxolan-2-ol?
The canonical SMILES for 2-(dichloromethyl)-1,3-dioxolan-2-ol is OC1(C(Cl)Cl)OCCO1.
What is the InChIKey of 2-(dichloromethyl)-1,3-dioxolan-2-ol?
The InChIKey is MWEVIXURMXKKSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Cl2O3/c5-3(6)4(7)8-1-2-9-4/h3,7H,1-2H2.
What are the key properties of 2-(dichloromethyl)-1,3-dioxolan-2-ol?
2-(dichloromethyl)-1,3-dioxolan-2-ol has a molecular weight of 172.99 g/mol, XLogP of 0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dichloromethyl)-1,3-dioxolan-2-ol is sourced from PubChem (CID 86116885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).