C4H6Cl2O3 — CID 86116885
2-(dichloromethyl)-1,3-dioxolan-2-ol (PubChem CID 86116885) has the molecular formula C4H6Cl2O3 and a molecular weight of 172.99 g/mol. Its IUPAC name is 2-(dichloromethyl)-1,3-dioxolan-2-ol.
| Compound Name | 2-(dichloromethyl)-1,3-dioxolan-2-ol |
|---|---|
| PubChem CID | 86116885 |
| Molecular Formula | C4H6Cl2O3 |
| Molecular Weight | 172.99 g/mol |
| Exact Mass | 171.97 |
| IUPAC Name | 2-(dichloromethyl)-1,3-dioxolan-2-ol |
| SMILES | OC1(C(Cl)Cl)OCCO1 |
| InChI | InChI=1S/C4H6Cl2O3/c5-3(6)4(7)8-1-2-9-4/h3,7H,1-2H2 |
| InChIKey | MWEVIXURMXKKSE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.99 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|