C11H8Cl2N2 — CID 86117027
3,5-dichloro-4-methyl-6-phenylpyridazine (PubChem CID 86117027) has the molecular formula C11H8Cl2N2 and a molecular weight of 239.11 g/mol. Its IUPAC name is 3,5-dichloro-4-methyl-6-phenylpyridazine.
| Compound Name | 3,5-dichloro-4-methyl-6-phenylpyridazine |
|---|---|
| PubChem CID | 86117027 |
| Molecular Formula | C11H8Cl2N2 |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 3,5-dichloro-4-methyl-6-phenylpyridazine |
| SMILES | Cc1c(Cl)nnc(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C11H8Cl2N2/c1-7-9(12)10(14-15-11(7)13)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | RILFZEZFMYGOQJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |