About 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene
3-(4-chlorophenyl)-1,2-dimethyl-1H-indene (PubChem CID 86117388) has the molecular formula C17H15Cl
and a molecular weight of 254.76 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene |
| PubChem CID | 86117388 |
| Molecular Formula | C17H15Cl |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene |
| SMILES | CC1=C(c2ccc(Cl)cc2)c2ccccc2C1C |
| InChI | InChI=1S/C17H15Cl/c1-11-12(2)17(13-7-9-14(18)10-8-13)16-6-4-3-5-15(11)16/h3-11H,1-2H3 |
| InChIKey | GUIOWMODSOAEOC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene?
The IUPAC name of 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene (CID 86117388) is 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene.
What is the SMILES notation for 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene?
The canonical SMILES for 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene is CC1=C(c2ccc(Cl)cc2)c2ccccc2C1C.
What is the InChIKey of 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene?
The InChIKey is GUIOWMODSOAEOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl/c1-11-12(2)17(13-7-9-14(18)10-8-13)16-6-4-3-5-15(11)16/h3-11H,1-2H3.
What are the key properties of 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene?
3-(4-chlorophenyl)-1,2-dimethyl-1H-indene has a molecular weight of 254.76 g/mol, XLogP of 5.28, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1,2-dimethyl-1H-indene is sourced from PubChem (CID 86117388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).