About 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one
2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one (PubChem CID 86117797) has the molecular formula C9H7FN2O2
and a molecular weight of 194.17 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one |
| PubChem CID | 86117797 |
| Molecular Formula | C9H7FN2O2 |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one |
| SMILES | O=C1CNN=C(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C9H7FN2O2/c10-7-3-1-6(2-4-7)9-12-11-5-8(13)14-9/h1-4,11H,5H2 |
| InChIKey | LMXIDXWSZZUATB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one?
The IUPAC name of 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one (CID 86117797) is 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one.
What is the SMILES notation for 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one?
The canonical SMILES for 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one is O=C1CNN=C(c2ccc(F)cc2)O1.
What is the InChIKey of 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one?
The InChIKey is LMXIDXWSZZUATB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN2O2/c10-7-3-1-6(2-4-7)9-12-11-5-8(13)14-9/h1-4,11H,5H2.
What are the key properties of 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one?
2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one has a molecular weight of 194.17 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-4,5-dihydro-1,3,4-oxadiazin-6-one is sourced from PubChem (CID 86117797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).