C24H30O3 — CID 86118759
2,2,4,4,6,6-hexakis(prop-2-enyl)cyclohexane-1,3,5-trione (PubChem CID 86118759) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexakis(prop-2-enyl)cyclohexane-1,3,5-trione.
| Compound Name | 2,2,4,4,6,6-hexakis(prop-2-enyl)cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 86118759 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2,2,4,4,6,6-hexakis(prop-2-enyl)cyclohexane-1,3,5-trione |
| SMILES | C=CCC1(CC=C)C(=O)C(CC=C)(CC=C)C(=O)C(CC=C)(CC=C)C1=O |
| InChI | InChI=1S/C24H30O3/c1-7-13-22(14-8-2)19(25)23(15-9-3,16-10-4)21(27)24(17-11-5,18-12-6)20(22)26/h7-12H,1-6,13-18H2 |
| InChIKey | WWLUFRQSONMNJC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|