C6H8F5NO2S — CID 86119514
2,2,3,3,3-pentafluoro-N-(2-methylsulfinylethyl)propanamide (PubChem CID 86119514) has the molecular formula C6H8F5NO2S and a molecular weight of 253.19 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(2-methylsulfinylethyl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(2-methylsulfinylethyl)propanamide |
|---|---|
| PubChem CID | 86119514 |
| Molecular Formula | C6H8F5NO2S |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(2-methylsulfinylethyl)propanamide |
| SMILES | CS(=O)CCNC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F5NO2S/c1-15(14)3-2-12-4(13)5(7,8)6(9,10)11/h2-3H2,1H3,(H,12,13) |
| InChIKey | OLHHZPZFSYLSQN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|