C24H29NO4 — CID 8611984
[2-[2,4-di(propan-2-yl)phenyl]-2-oxoethyl] 2-(4-acetamidophenyl)acetate (PubChem CID 8611984) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is [2-[2,4-di(propan-2-yl)phenyl]-2-oxoethyl] 2-(4-acetamidophenyl)acetate.
| Compound Name | [2-[2,4-di(propan-2-yl)phenyl]-2-oxoethyl] 2-(4-acetamidophenyl)acetate |
|---|---|
| PubChem CID | 8611984 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [2-[2,4-di(propan-2-yl)phenyl]-2-oxoethyl] 2-(4-acetamidophenyl)acetate |
| SMILES | CC(=O)Nc1ccc(CC(=O)OCC(=O)c2ccc(C(C)C)cc2C(C)C)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-15(2)19-8-11-21(22(13-19)16(3)4)23(27)14-29-24(28)12-18-6-9-20(10-7-18)25-17(5)26/h6-11,13,15-16H,12,14H2,1-5H3,(H,25,26) |
| InChIKey | FLZHOHOQEPDQNG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |