C13H17N3O2S2 — CID 8612023
3-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 8612023) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 8612023 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 3-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(SCCCC(=O)c2cccs2)n[nH]c1=O |
| InChI | InChI=1S/C13H17N3O2S2/c1-2-7-16-12(18)14-15-13(16)20-9-3-5-10(17)11-6-4-8-19-11/h4,6,8H,2-3,5,7,9H2,1H3,(H,14,18) |
| InChIKey | WLYDMIVANHZGRR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|