C22H28O — CID 86120683
1,1-bis(2,4,6-trimethylphenyl)but-1-en-2-ol (PubChem CID 86120683) has the molecular formula C22H28O and a molecular weight of 308.47 g/mol. Its IUPAC name is 1,1-bis(2,4,6-trimethylphenyl)but-1-en-2-ol.
| Compound Name | 1,1-bis(2,4,6-trimethylphenyl)but-1-en-2-ol |
|---|---|
| PubChem CID | 86120683 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1,1-bis(2,4,6-trimethylphenyl)but-1-en-2-ol |
| SMILES | CCC(O)=C(c1c(C)cc(C)cc1C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H28O/c1-8-19(23)22(20-15(4)9-13(2)10-16(20)5)21-17(6)11-14(3)12-18(21)7/h9-12,23H,8H2,1-7H3 |
| InChIKey | MWCBGHASJBFGRM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|