About ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate
ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate (PubChem CID 86120902) has the molecular formula C10H16F2O3
and a molecular weight of 222.23 g/mol. Its IUPAC name is ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate.
Molecular Properties
| Compound Name | ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate |
| PubChem CID | 86120902 |
| Molecular Formula | C10H16F2O3 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate |
| SMILES | CCOC(=O)C(=O)C(F)(F)CC(C)(C)C |
| InChI | InChI=1S/C10H16F2O3/c1-5-15-8(14)7(13)10(11,12)6-9(2,3)4/h5-6H2,1-4H3 |
| InChIKey | BMSKMGSZTINPNN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate?
The IUPAC name of ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate (CID 86120902) is ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate.
What is the SMILES notation for ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate?
The canonical SMILES for ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate is CCOC(=O)C(=O)C(F)(F)CC(C)(C)C.
What is the InChIKey of ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate?
The InChIKey is BMSKMGSZTINPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2O3/c1-5-15-8(14)7(13)10(11,12)6-9(2,3)4/h5-6H2,1-4H3.
What are the key properties of ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate?
ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate has a molecular weight of 222.23 g/mol, XLogP of 2.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,3-difluoro-5,5-dimethyl-2-oxohexanoate is sourced from PubChem (CID 86120902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).