About ethyl 2-acetyl-3,5-dimethylhex-2-enoate
ethyl 2-acetyl-3,5-dimethylhex-2-enoate (PubChem CID 86121742) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is ethyl 2-acetyl-3,5-dimethylhex-2-enoate.
Molecular Properties
| Compound Name | ethyl 2-acetyl-3,5-dimethylhex-2-enoate |
| PubChem CID | 86121742 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | ethyl 2-acetyl-3,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)C(C(C)=O)=C(C)CC(C)C |
| InChI | InChI=1S/C12H20O3/c1-6-15-12(14)11(10(5)13)9(4)7-8(2)3/h8H,6-7H2,1-5H3 |
| InChIKey | RODXQGZILMICSP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-acetyl-3,5-dimethylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-acetyl-3,5-dimethylhex-2-enoate?
The IUPAC name of ethyl 2-acetyl-3,5-dimethylhex-2-enoate (CID 86121742) is ethyl 2-acetyl-3,5-dimethylhex-2-enoate.
What is the SMILES notation for ethyl 2-acetyl-3,5-dimethylhex-2-enoate?
The canonical SMILES for ethyl 2-acetyl-3,5-dimethylhex-2-enoate is CCOC(=O)C(C(C)=O)=C(C)CC(C)C.
What is the InChIKey of ethyl 2-acetyl-3,5-dimethylhex-2-enoate?
The InChIKey is RODXQGZILMICSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-6-15-12(14)11(10(5)13)9(4)7-8(2)3/h8H,6-7H2,1-5H3.
What are the key properties of ethyl 2-acetyl-3,5-dimethylhex-2-enoate?
ethyl 2-acetyl-3,5-dimethylhex-2-enoate has a molecular weight of 212.29 g/mol, XLogP of 2.50, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-acetyl-3,5-dimethylhex-2-enoate is sourced from PubChem (CID 86121742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).