About 3,4,6-trimethoxyphenanthrene
3,4,6-trimethoxyphenanthrene (PubChem CID 86122044) has the molecular formula C17H16O3
and a molecular weight of 268.31 g/mol. Its IUPAC name is 3,4,6-trimethoxyphenanthrene.
Molecular Properties
| Compound Name | 3,4,6-trimethoxyphenanthrene |
| PubChem CID | 86122044 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3,4,6-trimethoxyphenanthrene |
| SMILES | COc1ccc2ccc3ccc(OC)c(OC)c3c2c1 |
| InChI | InChI=1S/C17H16O3/c1-18-13-8-6-11-4-5-12-7-9-15(19-2)17(20-3)16(12)14(11)10-13/h4-10H,1-3H3 |
| InChIKey | BPLAXUXVTBKFFG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3,4,6-trimethoxyphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,6-trimethoxyphenanthrene?
The IUPAC name of 3,4,6-trimethoxyphenanthrene (CID 86122044) is 3,4,6-trimethoxyphenanthrene.
What is the SMILES notation for 3,4,6-trimethoxyphenanthrene?
The canonical SMILES for 3,4,6-trimethoxyphenanthrene is COc1ccc2ccc3ccc(OC)c(OC)c3c2c1.
What is the InChIKey of 3,4,6-trimethoxyphenanthrene?
The InChIKey is BPLAXUXVTBKFFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3/c1-18-13-8-6-11-4-5-12-7-9-15(19-2)17(20-3)16(12)14(11)10-13/h4-10H,1-3H3.
What are the key properties of 3,4,6-trimethoxyphenanthrene?
3,4,6-trimethoxyphenanthrene has a molecular weight of 268.31 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6-trimethoxyphenanthrene is sourced from PubChem (CID 86122044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).