C11H6F7NO — CID 86122234
4-(2,2,3,3,4,4,4-heptafluorobutoxy)benzonitrile (PubChem CID 86122234) has the molecular formula C11H6F7NO and a molecular weight of 301.16 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,4-heptafluorobutoxy)benzonitrile.
| Compound Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)benzonitrile |
|---|---|
| PubChem CID | 86122234 |
| Molecular Formula | C11H6F7NO |
| Molecular Weight | 301.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)benzonitrile |
| SMILES | N#Cc1ccc(OCC(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H6F7NO/c12-9(13,10(14,15)11(16,17)18)6-20-8-3-1-7(5-19)2-4-8/h1-4H,6H2 |
| InChIKey | JBRMEHMMXZSKCN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.16 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|