About nona-6,7-dien-2-ol
nona-6,7-dien-2-ol (PubChem CID 86125656) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is nona-6,7-dien-2-ol.
Molecular Properties
| Compound Name | nona-6,7-dien-2-ol |
| PubChem CID | 86125656 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | nona-6,7-dien-2-ol |
| SMILES | CC=C=CCCCC(C)O |
| InChI | InChI=1S/C9H16O/c1-3-4-5-6-7-8-9(2)10/h3,5,9-10H,6-8H2,1-2H3 |
| InChIKey | AUWRKEAGCLCQSF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nona-6,7-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nona-6,7-dien-2-ol?
The IUPAC name of nona-6,7-dien-2-ol (CID 86125656) is nona-6,7-dien-2-ol.
What is the SMILES notation for nona-6,7-dien-2-ol?
The canonical SMILES for nona-6,7-dien-2-ol is CC=C=CCCCC(C)O.
What is the InChIKey of nona-6,7-dien-2-ol?
The InChIKey is AUWRKEAGCLCQSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c1-3-4-5-6-7-8-9(2)10/h3,5,9-10H,6-8H2,1-2H3.
What are the key properties of nona-6,7-dien-2-ol?
nona-6,7-dien-2-ol has a molecular weight of 140.23 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nona-6,7-dien-2-ol is sourced from PubChem (CID 86125656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).