About 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine
5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine (PubChem CID 86127014) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine.
Molecular Properties
| Compound Name | 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine |
| PubChem CID | 86127014 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine |
| SMILES | Cc1ccc(-c2ccc3n2CCC3)o1 |
| InChI | InChI=1S/C12H13NO/c1-9-4-7-12(14-9)11-6-5-10-3-2-8-13(10)11/h4-7H,2-3,8H2,1H3 |
| InChIKey | SEBQZNHXPWYZSW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine?
The IUPAC name of 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine (CID 86127014) is 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine.
What is the SMILES notation for 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine?
The canonical SMILES for 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine is Cc1ccc(-c2ccc3n2CCC3)o1.
What is the InChIKey of 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine?
The InChIKey is SEBQZNHXPWYZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-9-4-7-12(14-9)11-6-5-10-3-2-8-13(10)11/h4-7H,2-3,8H2,1H3.
What are the key properties of 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine?
5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine has a molecular weight of 187.24 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine is sourced from PubChem (CID 86127014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).