About 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine
6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine (PubChem CID 86127314) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine.
Molecular Properties
| Compound Name | 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine |
| PubChem CID | 86127314 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine |
| SMILES | Cc1ccc(-c2c(C)cc3n2CCC3)o1 |
| InChI | InChI=1S/C13H15NO/c1-9-8-11-4-3-7-14(11)13(9)12-6-5-10(2)15-12/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | LDTMEECXWUGWBZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine?
The IUPAC name of 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine (CID 86127314) is 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine.
What is the SMILES notation for 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine?
The canonical SMILES for 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine is Cc1ccc(-c2c(C)cc3n2CCC3)o1.
What is the InChIKey of 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine?
The InChIKey is LDTMEECXWUGWBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c1-9-8-11-4-3-7-14(11)13(9)12-6-5-10(2)15-12/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine?
6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine has a molecular weight of 201.27 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-(5-methylfuran-2-yl)-2,3-dihydro-1H-pyrrolizine is sourced from PubChem (CID 86127314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).