About 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one
5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one (PubChem CID 86127688) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one.
Molecular Properties
| Compound Name | 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one |
| PubChem CID | 86127688 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one |
| SMILES | CCCCCCCCCC12COC(C)(CC(=O)C1)O2 |
| InChI | InChI=1S/C16H28O3/c1-3-4-5-6-7-8-9-10-16-12-14(17)11-15(2,19-16)18-13-16/h3-13H2,1-2H3 |
| InChIKey | PIMWQQQJSCEAQD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one?
The IUPAC name of 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one (CID 86127688) is 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one.
What is the SMILES notation for 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one?
The canonical SMILES for 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one is CCCCCCCCCC12COC(C)(CC(=O)C1)O2.
What is the InChIKey of 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one?
The InChIKey is PIMWQQQJSCEAQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-3-4-5-6-7-8-9-10-16-12-14(17)11-15(2,19-16)18-13-16/h3-13H2,1-2H3.
What are the key properties of 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one?
5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one has a molecular weight of 268.40 g/mol, XLogP of 3.99, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-nonyl-6,8-dioxabicyclo[3.2.1]octan-3-one is sourced from PubChem (CID 86127688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).